C12H14N2O4S — CID 141002359
[(5S)-3-(4-cyanophenyl)-1,3-oxazolidin-5-yl]methyl methanesulfonate (PubChem CID 141002359) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is [(5S)-3-(4-cyanophenyl)-1,3-oxazolidin-5-yl]methyl methanesulfonate.
| Compound Name | [(5S)-3-(4-cyanophenyl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 141002359 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [(5S)-3-(4-cyanophenyl)-1,3-oxazolidin-5-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1CN(c2ccc(C#N)cc2)CO1 |
| InChI | InChI=1S/C12H14N2O4S/c1-19(15,16)18-8-12-7-14(9-17-12)11-4-2-10(6-13)3-5-11/h2-5,12H,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | FXQUYTKHERQNFY-LBPRGKRZSA-N |
| XLogP | 0.70 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|