C14H20N2O3 — CID 125134711
(2R,4S)-4-hydroxy-N-[2-(4-methylphenoxy)ethyl]pyrrolidine-2-carboxamide (PubChem CID 125134711) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R,4S)-4-hydroxy-N-[2-(4-methylphenoxy)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-4-hydroxy-N-[2-(4-methylphenoxy)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 125134711 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R,4S)-4-hydroxy-N-[2-(4-methylphenoxy)ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)[C@H]2C[C@H](O)CN2)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-10-2-4-12(5-3-10)19-7-6-15-14(18)13-8-11(17)9-16-13/h2-5,11,13,16-17H,6-9H2,1H3,(H,15,18)/t11-,13+/m0/s1 |
| InChIKey | HCACXSAPQNMSBG-WCQYABFASA-N |
| XLogP | 0.21 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|