C15H22N2O3 — CID 119746756
N-[2-(3,5-dimethylphenoxy)ethyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 119746756) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119746756 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)C2CC(O)CN2)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-10-5-11(2)7-13(6-10)20-4-3-16-15(19)14-8-12(18)9-17-14/h5-7,12,14,17-18H,3-4,8-9H2,1-2H3,(H,16,19) |
| InChIKey | LWHPPKCXCJBOJE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|