C18H26N2O3 — CID 94620545
cis-(1S,2R)-N-[3-[2-(3,5-dimethylphenoxy)ethylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 94620545) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is cis-(1S,2R)-N-[3-[2-(3,5-dimethylphenoxy)ethylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[3-[2-(3,5-dimethylphenoxy)ethylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94620545 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | cis-(1S,2R)-N-[3-[2-(3,5-dimethylphenoxy)ethylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | Cc1cc(C)cc(OCCNC(=O)CCNC(=O)[C@H]2C[C@H]2C)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-12-8-13(2)10-15(9-12)23-7-6-19-17(21)4-5-20-18(22)16-11-14(16)3/h8-10,14,16H,4-7,11H2,1-3H3,(H,19,21)(H,20,22)/t14-,16+/m1/s1 |
| InChIKey | CRPBETAPKGRKTC-ZBFHGGJFSA-N |
| XLogP | 1.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|