C17H22N4O3 — CID 91237486
(2S,4S)-4-hydroxy-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide (PubChem CID 91237486) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-hydroxy-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91237486 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S,4S)-4-hydroxy-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cn1cc(-c2cccc(OCCNC(=O)[C@@H]3C[C@H](O)CN3)c2)cn1 |
| InChI | InChI=1S/C17H22N4O3/c1-21-11-13(9-20-21)12-3-2-4-15(7-12)24-6-5-18-17(23)16-8-14(22)10-19-16/h2-4,7,9,11,14,16,19,22H,5-6,8,10H2,1H3,(H,18,23)/t14-,16-/m0/s1 |
| InChIKey | XQTSOVGDGDHHRR-HOCLYGCPSA-N |
| XLogP | 0.30 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|