C18H22F2N4O2 — CID 91157958
(2R)-4,4-difluoro-1-methyl-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide (PubChem CID 91157958) has the molecular formula C18H22F2N4O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2R)-4,4-difluoro-1-methyl-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-4,4-difluoro-1-methyl-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91157958 |
| Molecular Formula | C18H22F2N4O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2R)-4,4-difluoro-1-methyl-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CN1CC(F)(F)C[C@@H]1C(=O)NCCOc1cccc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C18H22F2N4O2/c1-23-12-18(19,20)9-16(23)17(25)21-6-7-26-15-5-3-4-13(8-15)14-10-22-24(2)11-14/h3-5,8,10-11,16H,6-7,9,12H2,1-2H3,(H,21,25)/t16-/m1/s1 |
| InChIKey | SSHOMQHBSMDGFJ-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|