C20H23N5O2 — CID 173044803
2-amino-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]-2-pyridin-2-ylpropanamide (PubChem CID 173044803) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-amino-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]-2-pyridin-2-ylpropanamide.
| Compound Name | 2-amino-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]-2-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 173044803 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-amino-N-[2-[3-(1-methylpyrazol-4-yl)phenoxy]ethyl]-2-pyridin-2-ylpropanamide |
| SMILES | Cn1cc(-c2cccc(OCCNC(=O)C(C)(N)c3ccccn3)c2)cn1 |
| InChI | InChI=1S/C20H23N5O2/c1-20(21,18-8-3-4-9-22-18)19(26)23-10-11-27-17-7-5-6-15(12-17)16-13-24-25(2)14-16/h3-9,12-14H,10-11,21H2,1-2H3,(H,23,26) |
| InChIKey | WCIOVLRLNIXUBG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|