C15H14FNO3S2 — CID 125136913
(3S)-3-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]thiolane-3-carboxylic acid (PubChem CID 125136913) has the molecular formula C15H14FNO3S2 and a molecular weight of 339.41 g/mol. Its IUPAC name is (3S)-3-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]thiolane-3-carboxylic acid.
| Compound Name | (3S)-3-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 125136913 |
| Molecular Formula | C15H14FNO3S2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (3S)-3-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)amino]thiolane-3-carboxylic acid |
| SMILES | Cc1c(C(=O)N[C@]2(C(=O)O)CCSC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C15H14FNO3S2/c1-8-11-9(16)3-2-4-10(11)22-12(8)13(18)17-15(14(19)20)5-6-21-7-15/h2-4H,5-7H2,1H3,(H,17,18)(H,19,20)/t15-/m1/s1 |
| InChIKey | YLSGJUPLRIKTRA-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |