C15H20N2O5S — CID 125137446
N-[(2R,3S)-2-cyclopropyl-3-methyloxolan-3-yl]-1-(4-nitrophenyl)methanesulfonamide (PubChem CID 125137446) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[(2R,3S)-2-cyclopropyl-3-methyloxolan-3-yl]-1-(4-nitrophenyl)methanesulfonamide.
| Compound Name | N-[(2R,3S)-2-cyclopropyl-3-methyloxolan-3-yl]-1-(4-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 125137446 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | N-[(2R,3S)-2-cyclopropyl-3-methyloxolan-3-yl]-1-(4-nitrophenyl)methanesulfonamide |
| SMILES | C[C@]1(NS(=O)(=O)Cc2ccc([N+](=O)[O-])cc2)CCO[C@@H]1C1CC1 |
| InChI | InChI=1S/C15H20N2O5S/c1-15(8-9-22-14(15)12-4-5-12)16-23(20,21)10-11-2-6-13(7-3-11)17(18)19/h2-3,6-7,12,14,16H,4-5,8-10H2,1H3/t14-,15+/m1/s1 |
| InChIKey | LYTMYJRGQBMQHJ-CABCVRRESA-N |
| XLogP | 1.97 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|