C14H24O4S2 — CID 12513963
13-butyl-1,11-dioxa-4,8-dithiacyclotetradecane-12,14-dione (PubChem CID 12513963) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 13-butyl-1,11-dioxa-4,8-dithiacyclotetradecane-12,14-dione.
| Compound Name | 13-butyl-1,11-dioxa-4,8-dithiacyclotetradecane-12,14-dione |
|---|---|
| PubChem CID | 12513963 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 13-butyl-1,11-dioxa-4,8-dithiacyclotetradecane-12,14-dione |
| SMILES | CCCCC1C(=O)OCCSCCCSCCOC1=O |
| InChI | InChI=1S/C14H24O4S2/c1-2-3-5-12-13(15)17-6-10-19-8-4-9-20-11-7-18-14(12)16/h12H,2-11H2,1H3 |
| InChIKey | KJAGJTKQIOCOMV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|