C21H20F18O6S — CID 139985298
2-[6-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)-6-oxohexan-3-yl]sulfanylacetic acid (PubChem CID 139985298) has the molecular formula C21H20F18O6S and a molecular weight of 742.42 g/mol. Its IUPAC name is 2-[6-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)-6-oxohexan-3-yl]sulfanylacetic acid.
| Compound Name | 2-[6-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)-6-oxohexan-3-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 139985298 |
| Molecular Formula | C21H20F18O6S |
| Molecular Weight | 742.42 g/mol |
| Exact Mass | 742.07 |
| IUPAC Name | 2-[6-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxycarbonyl)-6-oxohexan-3-yl]sulfanylacetic acid |
| SMILES | CCC(CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SCC(=O)O |
| InChI | InChI=1S/C21H20F18O6S/c1-2-9(46-8-11(40)41)7-10(12(42)44-5-3-14(22,23)16(26,27)18(30,31)20(34,35)36)13(43)45-6-4-15(24,25)17(28,29)19(32,33)21(37,38)39/h9-10H,2-8H2,1H3,(H,40,41) |
| InChIKey | RKXDKJJNSMRUEN-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.42 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|