C12H19F3O4S — CID 116628327
2-ethoxycarbonyl-4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid (PubChem CID 116628327) has the molecular formula C12H19F3O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 116628327 |
| Molecular Formula | C12H19F3O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-ethoxycarbonyl-4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid |
| SMILES | CCOC(=O)C(CCSC(F)(F)F)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H19F3O4S/c1-4-19-10(18)11(9(16)17,7-8(2)3)5-6-20-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | VIWQCEYDOQZLRC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|