C11H17F3O4S — CID 116628328
2-ethoxycarbonyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid (PubChem CID 116628328) has the molecular formula C11H17F3O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid |
|---|---|
| PubChem CID | 116628328 |
| Molecular Formula | C11H17F3O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-ethoxycarbonyl-2-[2-(trifluoromethylsulfanyl)ethyl]pentanoic acid |
| SMILES | CCCC(CCSC(F)(F)F)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C11H17F3O4S/c1-3-5-10(8(15)16,9(17)18-4-2)6-7-19-11(12,13)14/h3-7H2,1-2H3,(H,15,16) |
| InChIKey | VZEAWVLZBBECHM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|