C9H13F3O4S — CID 116628326
2-ethoxycarbonyl-2-methyl-4-(trifluoromethylsulfanyl)butanoic acid (PubChem CID 116628326) has the molecular formula C9H13F3O4S and a molecular weight of 274.26 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-methyl-4-(trifluoromethylsulfanyl)butanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-methyl-4-(trifluoromethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 116628326 |
| Molecular Formula | C9H13F3O4S |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-ethoxycarbonyl-2-methyl-4-(trifluoromethylsulfanyl)butanoic acid |
| SMILES | CCOC(=O)C(C)(CCSC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H13F3O4S/c1-3-16-7(15)8(2,6(13)14)4-5-17-9(10,11)12/h3-5H2,1-2H3,(H,13,14) |
| InChIKey | OFGUYMDXQNVHBL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|