C11H15F3O6S — CID 103973461
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid (PubChem CID 103973461) has the molecular formula C11H15F3O6S and a molecular weight of 332.30 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 103973461 |
| Molecular Formula | C11H15F3O6S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4,4-trifluorobutanoic acid |
| SMILES | CCOC(=O)C(CC(F)(F)F)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15F3O6S/c1-2-20-9(17)10(8(15)16,6-11(12,13)14)7-3-4-21(18,19)5-7/h7H,2-6H2,1H3,(H,15,16) |
| InChIKey | QUVDAYNWGQUTTL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|