C13H21FO6S — CID 103972505
diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-fluoroethyl)propanedioate (PubChem CID 103972505) has the molecular formula C13H21FO6S and a molecular weight of 324.37 g/mol. Its IUPAC name is diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-fluoroethyl)propanedioate.
| Compound Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-fluoroethyl)propanedioate |
|---|---|
| PubChem CID | 103972505 |
| Molecular Formula | C13H21FO6S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-(2-fluoroethyl)propanedioate |
| SMILES | CCOC(=O)C(CCF)(C(=O)OCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H21FO6S/c1-3-19-11(15)13(6-7-14,12(16)20-4-2)10-5-8-21(17,18)9-10/h10H,3-9H2,1-2H3 |
| InChIKey | LNKWPAHFALLCJA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|