C11H17FO6S — CID 103973450
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-fluorobutanoic acid (PubChem CID 103973450) has the molecular formula C11H17FO6S and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-fluorobutanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-fluorobutanoic acid |
|---|---|
| PubChem CID | 103973450 |
| Molecular Formula | C11H17FO6S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4-fluorobutanoic acid |
| SMILES | CCOC(=O)C(CCF)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H17FO6S/c1-2-18-10(15)11(4-5-12,9(13)14)8-3-6-19(16,17)7-8/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | JQAREAAOOHBRSH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|