C15H19ClN4O — CID 125141654
3-[3-[[(2R)-1-(3-chlorophenyl)propan-2-yl]amino]pyrazol-1-yl]propanamide (PubChem CID 125141654) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 3-[3-[[(2R)-1-(3-chlorophenyl)propan-2-yl]amino]pyrazol-1-yl]propanamide.
| Compound Name | 3-[3-[[(2R)-1-(3-chlorophenyl)propan-2-yl]amino]pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 125141654 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[3-[[(2R)-1-(3-chlorophenyl)propan-2-yl]amino]pyrazol-1-yl]propanamide |
| SMILES | C[C@H](Cc1cccc(Cl)c1)Nc1ccn(CCC(N)=O)n1 |
| InChI | InChI=1S/C15H19ClN4O/c1-11(9-12-3-2-4-13(16)10-12)18-15-6-8-20(19-15)7-5-14(17)21/h2-4,6,8,10-11H,5,7,9H2,1H3,(H2,17,21)(H,18,19)/t11-/m1/s1 |
| InChIKey | TYEFTXBVOHCMNA-LLVKDONJSA-N |
| XLogP | 2.45 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |