C18H24N4O3 — CID 125141826
2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]-2-oxoacetamide (PubChem CID 125141826) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]-2-oxoacetamide.
| Compound Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 125141826 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-N-[3-(2-methylbenzimidazol-1-yl)propyl]-2-oxoacetamide |
| SMILES | Cc1nc2ccccc2n1CCCNC(=O)C(=O)N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-20-15-7-2-3-8-16(15)22(13)11-5-9-19-17(24)18(25)21-10-4-6-14(23)12-21/h2-3,7-8,14,23H,4-6,9-12H2,1H3,(H,19,24)/t14-/m0/s1 |
| InChIKey | DITJCMCYKJTFCH-AWEZNQCLSA-N |
| XLogP | 0.83 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|