C19H17N3O3 — CID 1251429
(3aS,6aS)-1-benzyl-3-(4-methoxyphenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 1251429) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3aS,6aS)-1-benzyl-3-(4-methoxyphenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aS)-1-benzyl-3-(4-methoxyphenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 1251429 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3aS,6aS)-1-benzyl-3-(4-methoxyphenyl)-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | COc1ccc(C2=NN(Cc3ccccc3)[C@@H]3C(=O)NC(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-25-14-9-7-13(8-10-14)16-15-17(19(24)20-18(15)23)22(21-16)11-12-5-3-2-4-6-12/h2-10,15,17H,11H2,1H3,(H,20,23,24)/t15-,17+/m1/s1 |
| InChIKey | JYSDLZYVHVCVBI-WBVHZDCISA-N |
| XLogP | 1.56 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|