C21H22N4O2 — CID 98116705
(3aS,6aR)-1-benzyl-3-[4-(dimethylamino)phenyl]-5-methyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione (PubChem CID 98116705) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3aS,6aR)-1-benzyl-3-[4-(dimethylamino)phenyl]-5-methyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione.
| Compound Name | (3aS,6aR)-1-benzyl-3-[4-(dimethylamino)phenyl]-5-methyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 98116705 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3aS,6aR)-1-benzyl-3-[4-(dimethylamino)phenyl]-5-methyl-3a,6a-dihydropyrrolo[3,4-c]pyrazole-4,6-dione |
| SMILES | CN1C(=O)[C@@H]2C(c3ccc(N(C)C)cc3)=NN(Cc3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C21H22N4O2/c1-23(2)16-11-9-15(10-12-16)18-17-19(21(27)24(3)20(17)26)25(22-18)13-14-7-5-4-6-8-14/h4-12,17,19H,13H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | QXNNOGSBWVQXDF-IEBWSBKVSA-N |
| XLogP | 1.96 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|