C14H23N3OS2 — CID 125143068
(2R)-N-(2-propan-2-ylsulfanylethyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 125143068) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is (2R)-N-(2-propan-2-ylsulfanylethyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-(2-propan-2-ylsulfanylethyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125143068 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2R)-N-(2-propan-2-ylsulfanylethyl)-2-(1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | CC(C)SCCNC(=O)N1CCCC[C@@H]1c1nccs1 |
| InChI | InChI=1S/C14H23N3OS2/c1-11(2)19-9-7-16-14(18)17-8-4-3-5-12(17)13-15-6-10-20-13/h6,10-12H,3-5,7-9H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | LCFYIRYRSMWHGO-GFCCVEGCSA-N |
| XLogP | 3.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|