C16H20N2O5 — CID 125143991
ethyl 2-hydroxy-5-[[(2R)-7-oxoazepane-2-carbonyl]amino]benzoate (PubChem CID 125143991) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 2-hydroxy-5-[[(2R)-7-oxoazepane-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-hydroxy-5-[[(2R)-7-oxoazepane-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 125143991 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 2-hydroxy-5-[[(2R)-7-oxoazepane-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)[C@H]2CCCCC(=O)N2)ccc1O |
| InChI | InChI=1S/C16H20N2O5/c1-2-23-16(22)11-9-10(7-8-13(11)19)17-15(21)12-5-3-4-6-14(20)18-12/h7-9,12,19H,2-6H2,1H3,(H,17,21)(H,18,20)/t12-/m1/s1 |
| InChIKey | CNBCSLGHBCXBCK-GFCCVEGCSA-N |
| XLogP | 1.57 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|