C15H17NO6 — CID 125144290
ethyl 2-hydroxy-5-[[2-[(3R)-5-oxooxolan-3-yl]acetyl]amino]benzoate (PubChem CID 125144290) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is ethyl 2-hydroxy-5-[[2-[(3R)-5-oxooxolan-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-hydroxy-5-[[2-[(3R)-5-oxooxolan-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 125144290 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 2-hydroxy-5-[[2-[(3R)-5-oxooxolan-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C[C@H]2COC(=O)C2)ccc1O |
| InChI | InChI=1S/C15H17NO6/c1-2-21-15(20)11-7-10(3-4-12(11)17)16-13(18)5-9-6-14(19)22-8-9/h3-4,7,9,17H,2,5-6,8H2,1H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | SMHFTRUDISHHFB-SECBINFHSA-N |
| XLogP | 1.46 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|