C14H16ClF3N2O2 — CID 125144395
(3R)-N-[(1R)-1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethyl]oxane-3-carboxamide (PubChem CID 125144395) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is (3R)-N-[(1R)-1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethyl]oxane-3-carboxamide.
| Compound Name | (3R)-N-[(1R)-1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 125144395 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (3R)-N-[(1R)-1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]ethyl]oxane-3-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1CCCOC1)c1ccc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-8(19-13(21)9-3-2-6-22-7-9)10-4-5-11(14(16,17)18)20-12(10)15/h4-5,8-9H,2-3,6-7H2,1H3,(H,19,21)/t8-,9-/m1/s1 |
| InChIKey | WFSBXZUDKVJDRJ-RKDXNWHRSA-N |
| XLogP | 3.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|