C15H20BrNO3 — CID 125144702
N-[(1R)-1-(2-bromo-5-methoxyphenyl)-2-hydroxyethyl]-N,3-dimethylbut-2-enamide (PubChem CID 125144702) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromo-5-methoxyphenyl)-2-hydroxyethyl]-N,3-dimethylbut-2-enamide.
| Compound Name | N-[(1R)-1-(2-bromo-5-methoxyphenyl)-2-hydroxyethyl]-N,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 125144702 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[(1R)-1-(2-bromo-5-methoxyphenyl)-2-hydroxyethyl]-N,3-dimethylbut-2-enamide |
| SMILES | COc1ccc(Br)c([C@H](CO)N(C)C(=O)C=C(C)C)c1 |
| InChI | InChI=1S/C15H20BrNO3/c1-10(2)7-15(19)17(3)14(9-18)12-8-11(20-4)5-6-13(12)16/h5-8,14,18H,9H2,1-4H3/t14-/m0/s1 |
| InChIKey | IBUTYVYAXLIVMR-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|