C13H23NO5 — CID 125152183
2-methyl-2-[[(2S)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]propanoic acid (PubChem CID 125152183) has the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-methyl-2-[[(2S)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[(2S)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 125152183 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-methyl-2-[[(2S)-2-[[(2R)-oxan-2-yl]methoxy]propanoyl]amino]propanoic acid |
| SMILES | C[C@H](OC[C@H]1CCCCO1)C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H23NO5/c1-9(11(15)14-13(2,3)12(16)17)19-8-10-6-4-5-7-18-10/h9-10H,4-8H2,1-3H3,(H,14,15)(H,16,17)/t9-,10+/m0/s1 |
| InChIKey | NIUCZOYVZPBPQF-VHSXEESVSA-N |
| XLogP | 0.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |