C15H25N3O3S2 — CID 125154915
N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]acetamide (PubChem CID 125154915) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]acetamide.
| Compound Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]acetamide |
|---|---|
| PubChem CID | 125154915 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]acetamide |
| SMILES | Cc1nc(CCCNC(=O)CN(C)[C@@H]2CCS(=O)(=O)C2)sc1C |
| InChI | InChI=1S/C15H25N3O3S2/c1-11-12(2)22-15(17-11)5-4-7-16-14(19)9-18(3)13-6-8-23(20,21)10-13/h13H,4-10H2,1-3H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | BDDAJQDAXWECMD-CYBMUJFWSA-N |
| XLogP | 0.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|