C17H28N4O2 — CID 125158263
4-imidazol-1-yl-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]butanamide (PubChem CID 125158263) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]butanamide.
| Compound Name | 4-imidazol-1-yl-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 125158263 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 4-imidazol-1-yl-N-[1-[[(2S)-oxolan-2-yl]methyl]piperidin-4-yl]butanamide |
| SMILES | O=C(CCCn1ccnc1)NC1CCN(C[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c22-17(4-1-8-21-11-7-18-14-21)19-15-5-9-20(10-6-15)13-16-3-2-12-23-16/h7,11,14-16H,1-6,8-10,12-13H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | RVDABVZSTQPZPI-INIZCTEOSA-N |
| XLogP | 1.42 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |