C24H33FN4O — CID 95853122
N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-4-imidazol-1-ylbutanamide (PubChem CID 95853122) has the molecular formula C24H33FN4O and a molecular weight of 412.55 g/mol. Its IUPAC name is N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-4-imidazol-1-ylbutanamide.
| Compound Name | N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-4-imidazol-1-ylbutanamide |
|---|---|
| PubChem CID | 95853122 |
| Molecular Formula | C24H33FN4O |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-4-imidazol-1-ylbutanamide |
| SMILES | O=C(CCCn1ccnc1)NC1CCN(CC2(c3cccc(F)c3)CCCC2)CC1 |
| InChI | InChI=1S/C24H33FN4O/c25-21-6-3-5-20(17-21)24(10-1-2-11-24)18-28-14-8-22(9-15-28)27-23(30)7-4-13-29-16-12-26-19-29/h3,5-6,12,16-17,19,22H,1-2,4,7-11,13-15,18H2,(H,27,30) |
| InChIKey | PEJUKYFSLJNCCR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |