C24H30FN3O — CID 92577364
N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-2-pyridin-2-ylacetamide (PubChem CID 92577364) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 92577364 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[1-[[1-(3-fluorophenyl)cyclopentyl]methyl]piperidin-4-yl]-2-pyridin-2-ylacetamide |
| SMILES | O=C(Cc1ccccn1)NC1CCN(CC2(c3cccc(F)c3)CCCC2)CC1 |
| InChI | InChI=1S/C24H30FN3O/c25-20-7-5-6-19(16-20)24(11-2-3-12-24)18-28-14-9-21(10-15-28)27-23(29)17-22-8-1-4-13-26-22/h1,4-8,13,16,21H,2-3,9-12,14-15,17-18H2,(H,27,29) |
| InChIKey | DJKALYBTETVBTF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |