C13H22N4O2 — CID 125161884
N-[2-[(3R)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-1-methylimidazole-2-carboxamide (PubChem CID 125161884) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-[2-[(3R)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-1-methylimidazole-2-carboxamide.
| Compound Name | N-[2-[(3R)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 125161884 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-[2-[(3R)-3-(hydroxymethyl)piperidin-1-yl]ethyl]-1-methylimidazole-2-carboxamide |
| SMILES | Cn1ccnc1C(=O)NCCN1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C13H22N4O2/c1-16-7-4-14-12(16)13(19)15-5-8-17-6-2-3-11(9-17)10-18/h4,7,11,18H,2-3,5-6,8-10H2,1H3,(H,15,19)/t11-/m1/s1 |
| InChIKey | SCRDDPUOXRKXGL-LLVKDONJSA-N |
| XLogP | -0.15 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |