C12H21N3OS — CID 131893362
[1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol (PubChem CID 131893362) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 131893362 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(CCNCc2nccs2)C1 |
| InChI | InChI=1S/C12H21N3OS/c16-10-11-2-1-5-15(9-11)6-3-13-8-12-14-4-7-17-12/h4,7,11,13,16H,1-3,5-6,8-10H2 |
| InChIKey | XTHHZMLYMDEHLU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|