About [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol
[1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol (PubChem CID 131893362) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol |
| PubChem CID | 131893362 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(CCNCc2nccs2)C1 |
| InChI | InChI=1S/C12H21N3OS/c16-10-11-2-1-5-15(9-11)6-3-13-8-12-14-4-7-17-12/h4,7,11,13,16H,1-3,5-6,8-10H2 |
| InChIKey | XTHHZMLYMDEHLU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol?
The IUPAC name of [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol (CID 131893362) is [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol.
What is the SMILES notation for [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol?
The canonical SMILES for [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol is OCC1CCCN(CCNCc2nccs2)C1.
What is the InChIKey of [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol?
The InChIKey is XTHHZMLYMDEHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c16-10-11-2-1-5-15(9-11)6-3-13-8-12-14-4-7-17-12/h4,7,11,13,16H,1-3,5-6,8-10H2.
What are the key properties of [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol?
[1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol has a molecular weight of 255.39 g/mol, XLogP of 0.94, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,3-thiazol-2-ylmethylamino)ethyl]piperidin-3-yl]methanol is sourced from PubChem (CID 131893362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).