C19H30N2O2 — CID 131929726
[1-[2-[(4-methoxy-3-prop-2-enylphenyl)methylamino]ethyl]piperidin-3-yl]methanol (PubChem CID 131929726) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is [1-[2-[(4-methoxy-3-prop-2-enylphenyl)methylamino]ethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-[(4-methoxy-3-prop-2-enylphenyl)methylamino]ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 131929726 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | [1-[2-[(4-methoxy-3-prop-2-enylphenyl)methylamino]ethyl]piperidin-3-yl]methanol |
| SMILES | C=CCc1cc(CNCCN2CCCC(CO)C2)ccc1OC |
| InChI | InChI=1S/C19H30N2O2/c1-3-5-18-12-16(7-8-19(18)23-2)13-20-9-11-21-10-4-6-17(14-21)15-22/h3,7-8,12,17,20,22H,1,4-6,9-11,13-15H2,2H3 |
| InChIKey | HVXPJQAZQYKJSR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|