C24H33NO6 — CID 71439560
[1-(2-phenylethyl)piperidin-3-yl]methanol;3,4,5-trimethoxybenzoic acid (PubChem CID 71439560) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is [1-(2-phenylethyl)piperidin-3-yl]methanol;3,4,5-trimethoxybenzoic acid.
| Compound Name | [1-(2-phenylethyl)piperidin-3-yl]methanol;3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 71439560 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [1-(2-phenylethyl)piperidin-3-yl]methanol;3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC.OCC1CCCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C14H21NO.C10H12O5/c16-12-14-7-4-9-15(11-14)10-8-13-5-2-1-3-6-13;1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h1-3,5-6,14,16H,4,7-12H2;4-5H,1-3H3,(H,11,12) |
| InChIKey | JKDZMXFHNLYMAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |