C15H24ClN3O — CID 131908054
[1-[3-[(4-chloro-3-pyridinyl)methylamino]propyl]piperidin-3-yl]methanol (PubChem CID 131908054) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is [1-[3-[(4-chloro-3-pyridinyl)methylamino]propyl]piperidin-3-yl]methanol.
| Compound Name | [1-[3-[(4-chloro-3-pyridinyl)methylamino]propyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 131908054 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [1-[3-[(4-chloro-3-pyridinyl)methylamino]propyl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(CCCNCc2cnccc2Cl)C1 |
| InChI | InChI=1S/C15H24ClN3O/c16-15-4-6-18-10-14(15)9-17-5-2-8-19-7-1-3-13(11-19)12-20/h4,6,10,13,17,20H,1-3,5,7-9,11-12H2 |
| InChIKey | BQBJBSDVUAFBNU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|