C20H23N5O3 — CID 125165743
1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[(2S)-2-(3,5-dimethylpyrazol-1-yl)propyl]urea (PubChem CID 125165743) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[(2S)-2-(3,5-dimethylpyrazol-1-yl)propyl]urea.
| Compound Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[(2S)-2-(3,5-dimethylpyrazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 125165743 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[(2S)-2-(3,5-dimethylpyrazol-1-yl)propyl]urea |
| SMILES | Cc1cc(C)n([C@@H](C)CNC(=O)Nc2ccc3c(c2)C(=O)N(C2CC2)C3=O)n1 |
| InChI | InChI=1S/C20H23N5O3/c1-11-8-12(2)25(23-11)13(3)10-21-20(28)22-14-4-7-16-17(9-14)19(27)24(18(16)26)15-5-6-15/h4,7-9,13,15H,5-6,10H2,1-3H3,(H2,21,22,28)/t13-/m0/s1 |
| InChIKey | CDRFXNCRDDPBJD-ZDUSSCGKSA-N |
| XLogP | 2.64 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|