C19H24N4O4 — CID 126449692
1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[[(6R)-4-methyl-1,4-oxazepan-6-yl]methyl]urea (PubChem CID 126449692) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[[(6R)-4-methyl-1,4-oxazepan-6-yl]methyl]urea.
| Compound Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[[(6R)-4-methyl-1,4-oxazepan-6-yl]methyl]urea |
|---|---|
| PubChem CID | 126449692 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-[[(6R)-4-methyl-1,4-oxazepan-6-yl]methyl]urea |
| SMILES | CN1CCOC[C@H](CNC(=O)Nc2ccc3c(c2)C(=O)N(C2CC2)C3=O)C1 |
| InChI | InChI=1S/C19H24N4O4/c1-22-6-7-27-11-12(10-22)9-20-19(26)21-13-2-5-15-16(8-13)18(25)23(17(15)24)14-3-4-14/h2,5,8,12,14H,3-4,6-7,9-11H2,1H3,(H2,20,21,26)/t12-/m1/s1 |
| InChIKey | CWPLECCCVYXJQA-GFCCVEGCSA-N |
| XLogP | 1.14 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|