C14H21ClN4O4S — CID 125170831
1-(2-chloro-5-sulfamoylphenyl)-3-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methyl]urea (PubChem CID 125170831) has the molecular formula C14H21ClN4O4S and a molecular weight of 376.87 g/mol. Its IUPAC name is 1-(2-chloro-5-sulfamoylphenyl)-3-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methyl]urea.
| Compound Name | 1-(2-chloro-5-sulfamoylphenyl)-3-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methyl]urea |
|---|---|
| PubChem CID | 125170831 |
| Molecular Formula | C14H21ClN4O4S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(2-chloro-5-sulfamoylphenyl)-3-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methyl]urea |
| SMILES | CN1CCOC[C@@H](CNC(=O)Nc2cc(S(N)(=O)=O)ccc2Cl)C1 |
| InChI | InChI=1S/C14H21ClN4O4S/c1-19-4-5-23-9-10(8-19)7-17-14(20)18-13-6-11(24(16,21)22)2-3-12(13)15/h2-3,6,10H,4-5,7-9H2,1H3,(H2,16,21,22)(H2,17,18,20)/t10-/m0/s1 |
| InChIKey | JUUIZKANKOWJJP-JTQLQIEISA-N |
| XLogP | 0.69 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |