C17H21ClN4O4 — CID 154901402
1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-(morpholin-2-ylmethyl)urea;hydrochloride (PubChem CID 154901402) has the molecular formula C17H21ClN4O4 and a molecular weight of 380.83 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-(morpholin-2-ylmethyl)urea;hydrochloride.
| Compound Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-(morpholin-2-ylmethyl)urea;hydrochloride |
|---|---|
| PubChem CID | 154901402 |
| Molecular Formula | C17H21ClN4O4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-dioxoisoindol-5-yl)-3-(morpholin-2-ylmethyl)urea;hydrochloride |
| SMILES | Cl.O=C(NCC1CNCCO1)Nc1ccc2c(c1)C(=O)N(C1CC1)C2=O |
| InChI | InChI=1S/C17H20N4O4.ClH/c22-15-13-4-1-10(7-14(13)16(23)21(15)11-2-3-11)20-17(24)19-9-12-8-18-5-6-25-12;/h1,4,7,11-12,18H,2-3,5-6,8-9H2,(H2,19,20,24);1H |
| InChIKey | XQJASUFVUCJKHI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|