C13H16F3N3O2 — CID 61315356
1-(morpholin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 61315356) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is 1-(morpholin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(morpholin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 61315356 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(morpholin-2-ylmethyl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCC1CNCCO1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)9-2-1-3-10(6-9)19-12(20)18-8-11-7-17-4-5-21-11/h1-3,6,11,17H,4-5,7-8H2,(H2,18,19,20) |
| InChIKey | GQBSSLXFPXQBHA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |