C16H20N6O3 — CID 125166126
benzyl (3R)-3-[(1-methyltriazol-4-yl)carbamoylamino]pyrrolidine-1-carboxylate (PubChem CID 125166126) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is benzyl (3R)-3-[(1-methyltriazol-4-yl)carbamoylamino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[(1-methyltriazol-4-yl)carbamoylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 125166126 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | benzyl (3R)-3-[(1-methyltriazol-4-yl)carbamoylamino]pyrrolidine-1-carboxylate |
| SMILES | Cn1cc(NC(=O)N[C@@H]2CCN(C(=O)OCc3ccccc3)C2)nn1 |
| InChI | InChI=1S/C16H20N6O3/c1-21-10-14(19-20-21)18-15(23)17-13-7-8-22(9-13)16(24)25-11-12-5-3-2-4-6-12/h2-6,10,13H,7-9,11H2,1H3,(H2,17,18,23)/t13-/m1/s1 |
| InChIKey | KMLZJZGPDSCGTD-CYBMUJFWSA-N |
| XLogP | 1.35 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |