C18H31N5O — CID 125167603
1-[2-[(2S)-butan-2-yl]pyrazol-3-yl]-3-[(1-pyrrolidin-1-ylcyclopentyl)methyl]urea (PubChem CID 125167603) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[2-[(2S)-butan-2-yl]pyrazol-3-yl]-3-[(1-pyrrolidin-1-ylcyclopentyl)methyl]urea.
| Compound Name | 1-[2-[(2S)-butan-2-yl]pyrazol-3-yl]-3-[(1-pyrrolidin-1-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 125167603 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 1-[2-[(2S)-butan-2-yl]pyrazol-3-yl]-3-[(1-pyrrolidin-1-ylcyclopentyl)methyl]urea |
| SMILES | CC[C@H](C)n1nccc1NC(=O)NCC1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C18H31N5O/c1-3-15(2)23-16(8-11-20-23)21-17(24)19-14-18(9-4-5-10-18)22-12-6-7-13-22/h8,11,15H,3-7,9-10,12-14H2,1-2H3,(H2,19,21,24)/t15-/m0/s1 |
| InChIKey | RTJBZEOWQJZNKC-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |