C19H33N5O2 — CID 125172155
1-[1-(morpholin-4-ylmethyl)cyclopentyl]-3-[2-[(2S)-pentan-2-yl]pyrazol-3-yl]urea (PubChem CID 125172155) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[1-(morpholin-4-ylmethyl)cyclopentyl]-3-[2-[(2S)-pentan-2-yl]pyrazol-3-yl]urea.
| Compound Name | 1-[1-(morpholin-4-ylmethyl)cyclopentyl]-3-[2-[(2S)-pentan-2-yl]pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 125172155 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 1-[1-(morpholin-4-ylmethyl)cyclopentyl]-3-[2-[(2S)-pentan-2-yl]pyrazol-3-yl]urea |
| SMILES | CCC[C@H](C)n1nccc1NC(=O)NC1(CN2CCOCC2)CCCC1 |
| InChI | InChI=1S/C19H33N5O2/c1-3-6-16(2)24-17(7-10-20-24)21-18(25)22-19(8-4-5-9-19)15-23-11-13-26-14-12-23/h7,10,16H,3-6,8-9,11-15H2,1-2H3,(H2,21,22,25)/t16-/m0/s1 |
| InChIKey | YWHWYSACDWKBCW-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |