C18H27N7O — CID 125163687
1-[2-[(2R)-pentan-2-yl]pyrazol-3-yl]-3-(1-pyrazin-2-ylpiperidin-4-yl)urea (PubChem CID 125163687) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-[2-[(2R)-pentan-2-yl]pyrazol-3-yl]-3-(1-pyrazin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[2-[(2R)-pentan-2-yl]pyrazol-3-yl]-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 125163687 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-[2-[(2R)-pentan-2-yl]pyrazol-3-yl]-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
| SMILES | CCC[C@@H](C)n1nccc1NC(=O)NC1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C18H27N7O/c1-3-4-14(2)25-16(5-8-21-25)23-18(26)22-15-6-11-24(12-7-15)17-13-19-9-10-20-17/h5,8-10,13-15H,3-4,6-7,11-12H2,1-2H3,(H2,22,23,26)/t14-/m1/s1 |
| InChIKey | REERYLOZPPUOIP-CQSZACIVSA-N |
| XLogP | 2.82 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |