C15H22N8O — CID 118789447
1-(1-propyltriazol-4-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea (PubChem CID 118789447) has the molecular formula C15H22N8O and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-(1-propyltriazol-4-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(1-propyltriazol-4-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 118789447 |
| Molecular Formula | C15H22N8O |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-(1-propyltriazol-4-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
| SMILES | CCCn1cc(NC(=O)NC2CCN(c3cnccn3)CC2)nn1 |
| InChI | InChI=1S/C15H22N8O/c1-2-7-23-11-13(20-21-23)19-15(24)18-12-3-8-22(9-4-12)14-10-16-5-6-17-14/h5-6,10-12H,2-4,7-9H2,1H3,(H2,18,19,24) |
| InChIKey | SXMOLKMOPPPBQR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |