C18H20N6OS — CID 118784685
1-(2-methyl-1,3-benzothiazol-5-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea (PubChem CID 118784685) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 1-(2-methyl-1,3-benzothiazol-5-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methyl-1,3-benzothiazol-5-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 118784685 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(2-methyl-1,3-benzothiazol-5-yl)-3-(1-pyrazin-2-ylpiperidin-4-yl)urea |
| SMILES | Cc1nc2cc(NC(=O)NC3CCN(c4cnccn4)CC3)ccc2s1 |
| InChI | InChI=1S/C18H20N6OS/c1-12-21-15-10-14(2-3-16(15)26-12)23-18(25)22-13-4-8-24(9-5-13)17-11-19-6-7-20-17/h2-3,6-7,10-11,13H,4-5,8-9H2,1H3,(H2,22,23,25) |
| InChIKey | PJCNDHDPOZQBDJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |