C17H18N6OS — CID 126766366
1-(1,3-benzothiazol-5-yl)-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea (PubChem CID 126766366) has the molecular formula C17H18N6OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-5-yl)-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(1,3-benzothiazol-5-yl)-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126766366 |
| Molecular Formula | C17H18N6OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-(1,3-benzothiazol-5-yl)-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(Nc1ccc2scnc2c1)NC1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H18N6OS/c24-17(22-13-2-3-15-14(10-13)20-11-25-15)21-12-4-8-23(9-5-12)16-18-6-1-7-19-16/h1-3,6-7,10-12H,4-5,8-9H2,(H2,21,22,24) |
| InChIKey | FTCHTRJAEHUGHO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |