C18H20N6O2 — CID 55695844
1-[4-(cyanomethoxy)phenyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea (PubChem CID 55695844) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-[4-(cyanomethoxy)phenyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-[4-(cyanomethoxy)phenyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 55695844 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-[4-(cyanomethoxy)phenyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)urea |
| SMILES | N#CCOc1ccc(NC(=O)NC2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C18H20N6O2/c19-8-13-26-16-4-2-14(3-5-16)22-18(25)23-15-6-11-24(12-7-15)17-20-9-1-10-21-17/h1-5,9-10,15H,6-7,11-13H2,(H2,22,23,25) |
| InChIKey | LJPATJBFGJHDIH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |