C17H16ClN5OS — CID 166239062
N-(2-chloro-1,3-benzothiazol-6-yl)-1-pyrazin-2-ylpiperidine-4-carboxamide (PubChem CID 166239062) has the molecular formula C17H16ClN5OS and a molecular weight of 373.87 g/mol. Its IUPAC name is N-(2-chloro-1,3-benzothiazol-6-yl)-1-pyrazin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-(2-chloro-1,3-benzothiazol-6-yl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166239062 |
| Molecular Formula | C17H16ClN5OS |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(2-chloro-1,3-benzothiazol-6-yl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2nc(Cl)sc2c1)C1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C17H16ClN5OS/c18-17-22-13-2-1-12(9-14(13)25-17)21-16(24)11-3-7-23(8-4-11)15-10-19-5-6-20-15/h1-2,5-6,9-11H,3-4,7-8H2,(H,21,24) |
| InChIKey | RECIAWWNKBGUKU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |